* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115344-001 |
English Synonyms: | WUXIAPPTEC WX115344-005 ; WUXIAPPTEC WX115344-010 ; WUXIAPPTEC WX115344-001 |
MDL Number.: | MFCD17017623 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | [H][C@]12CN(C[C@@]1([H])[C@H]1NCCO[C@H]1CO2)C(=O)OC(C)(C)C |
InChi: | InChI=1S/C14H24N2O4/c1-14(2,3)20-13(17)16-6-9-10(7-16)19-8-11-12(9)15-4-5-18-11/h9-12,15H,4-8H2,1-3H3/t9-,10+,11+,12-/m1/s1 |
InChiKey: | InChIKey=YQKMGGOVDTVEKP-NOOOWODRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.