* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CYCLOPENTANOL, 2-(1-OCTENYL)-, TRANS- |
| CAS: | 834899-01-3 |
| English Synonyms: | CYCLOPENTANOL, 2-(1-OCTENYL)-, TRANS- |
| MDL Number.: | MFCD17017837 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCCCCC/C=C/[C@@H]1CCC[C@H]1O |
| InChi: | InChI=1S/C13H24O/c1-2-3-4-5-6-7-9-12-10-8-11-13(12)14/h7,9,12-14H,2-6,8,10-11H2,1H3/b9-7+/t12-,13-/m1/s1 |
| InChiKey: | InChIKey=GTYXKBIQFNWCAQ-SKFMMRCFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.