* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-AZABICYCLO[2.2.1]HEPTANE,2-BROMO-,(1R,2S,4S)-REL- |
CAS: | 836607-81-9 |
English Synonyms: | 7-AZABICYCLO[2.2.1]HEPTANE,2-BROMO-,(1R,2S,4S)-REL- |
MDL Number.: | MFCD17017841 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | [H][C@@]12CC[C@@]([H])(N1)[C@@H](Br)C2 |
InChi: | InChI=1S/C6H10BrN/c7-5-3-4-1-2-6(5)8-4/h4-6,8H,1-3H2/t4-,5-,6+/m0/s1 |
InChiKey: | InChIKey=MBHIMWOOKLHTHT-HCWXCVPCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.