* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BICYCLO[2.2.2]OCT-5-EN-2-OL, 7-ETHENYL-5-METHYL-3-METHYLENE-, (1R,4S,7R)-REL- |
| CAS: | 845293-91-6 |
| English Synonyms: | BICYCLO[2.2.2]OCT-5-EN-2-OL, 7-ETHENYL-5-METHYL-3-METHYLENE-, (1R,4S,7R)-REL- |
| MDL Number.: | MFCD17017870 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | [H][C@]12C=C(C)[C@]([H])(C[C@@H]1C=C)C(=C)C2O |
| InChi: | InChI=1S/C12H16O/c1-4-9-6-10-7(2)5-11(9)12(13)8(10)3/h4-5,9-13H,1,3,6H2,2H3/t9-,10-,11-,12?/m0/s1 |
| InChiKey: | InChIKey=BBGGCWBENMWXKD-XOGOEWOHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.