* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BICYCLO[2.2.2]OCT-5-EN-2-ONE, 7-ETHENYL-3,3-DIMETHYL-, (1R,4R,7S)-REL- |
| CAS: | 845293-94-9 |
| English Synonyms: | BICYCLO[2.2.2]OCT-5-EN-2-ONE, 7-ETHENYL-3,3-DIMETHYL-, (1R,4R,7S)-REL- |
| MDL Number.: | MFCD17017871 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | [H][C@]12C[C@@H](C=C)[C@]([H])(C=C1C)C(=O)C2=C |
| InChi: | InChI=1S/C12H14O/c1-4-9-6-10-7(2)5-11(9)12(13)8(10)3/h4-5,9-11H,1,3,6H2,2H3/t9-,10+,11+/m1/s1 |
| InChiKey: | InChIKey=WHRSMEODMPJZTO-VWYCJHECSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.