* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DALTON DC-001148 |
| CAS: | 845883-03-6 |
| English Synonyms: | DALTON DC-001148 |
| MDL Number.: | MFCD17017885 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(C)OC(=O)/C=C/c1ccc(c(c1)O)O |
| InChi: | InChI=1S/C12H14O4/c1-8(2)16-12(15)6-4-9-3-5-10(13)11(14)7-9/h3-8,13-14H,1-2H3/b6-4+ |
| InChiKey: | InChIKey=HUBVPNVELDTWJF-GQCTYLIASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.