* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FURO[4,3,2-DE][1]BENZOPYRAN, 5A,6,7,8-TETRAHYDRO-3-METHYL-, (5AR)- |
CAS: | 845962-06-3 |
English Synonyms: | FURO[4,3,2-DE][1]BENZOPYRAN, 5A,6,7,8-TETRAHYDRO-3-METHYL-, (5AR)- |
MDL Number.: | MFCD17017889 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC1=CO[C@@H]2CCCc3c2c1co3 |
InChi: | InChI=1S/C11H12O2/c1-7-5-12-9-3-2-4-10-11(9)8(7)6-13-10/h5-6,9H,2-4H2,1H3/t9-/m1/s1 |
InChiKey: | InChIKey=VMKWOGWTCXYGOS-SECBINFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.