* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8H-PURIN-8-IMINE, N-IMINO- |
| CAS: | 860410-38-4 |
| English Synonyms: | N-IMINO-8H-PURIN-8-IMINE ; 8H-PURIN-8-IMINE, N-IMINO- |
| MDL Number.: | MFCD17018215 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | c1c2=NC(=[N+]=[N-])N=c2ncn1 |
| InChi: | InChI=1S/C5H2N6/c6-11-5-9-3-1-7-2-8-4(3)10-5/h1-2H |
| InChiKey: | InChIKey=JXCUIRPQHCYCKN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.