* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-QUINOLINAMINE, 7-(1,3-DIOXAN-2-YL)- |
CAS: | 863549-16-0 |
English Synonyms: | 2-QUINOLINAMINE, 7-(1,3-DIOXAN-2-YL)- ; 7-(1,3-DIOXAN-2-YL)-2-QUINOLINAMINE |
MDL Number.: | MFCD17018311 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(cc2c1ccc(n2)N)C3OCCCO3 |
InChi: | InChI=1S/C13H14N2O2/c14-12-5-4-9-2-3-10(8-11(9)15-12)13-16-6-1-7-17-13/h2-5,8,13H,1,6-7H2,(H2,14,15) |
InChiKey: | InChIKey=CCNBGLJJVSZMHZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.