* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BENZO[1,2-B:4,5-B]DIFURAN-2,6-DIAMINE, N-ETHYL- |
| CAS: | 863992-65-8 |
| English Synonyms: | BENZO[1,2-B:4,5-B]DIFURAN-2,6-DIAMINE, N-ETHYL- ; N-ETHYL-BENZO[1,2-B:4,5-B]DIFURAN-2,6-DIAMINE |
| MDL Number.: | MFCD17018318 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCNc1cc2cc3c(cc2o1)cc(o3)N |
| InChi: | InChI=1S/C12H12N2O2/c1-2-14-12-6-8-4-9-7(3-10(8)16-12)5-11(13)15-9/h3-6,14H,2,13H2,1H3 |
| InChiKey: | InChIKey=ZTHGEJMLSFUVPH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.