* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYL-CAMPHENE |
| CAS: | 871882-84-7 |
| English Synonyms: | CAMPHENE, 8-METHYL- ; 8-METHYL-CAMPHENE |
| MDL Number.: | MFCD17018372 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | C/C=C/1\[C@@H]2CC[C@@H](C2)C1(C)C |
| InChi: | InChI=1S/C11H18/c1-4-10-8-5-6-9(7-8)11(10,2)3/h4,8-9H,5-7H2,1-3H3/b10-4+/t8-,9+/m1/s1 |
| InChiKey: | InChIKey=JZWOFBQYGICYBX-CMQUBOLUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.