* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH1147827 |
| English Synonyms: | FCHGROUP FCH1147827 |
| MDL Number.: | MFCD17018410 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | COC(=O)n\1/cc\cc/cc\cc1 |
| InChi: | InChI=1S/C10H11NO2/c1-13-10(12)11-8-6-4-2-3-5-7-9-11/h2-9H,1H3/b4-2-,5-3-,8-6-,9-7- |
| InChiKey: | InChIKey=QEOVTPTVTZHMHD-KMHXQRNQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.