* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VALINE, N-(2-CHLOROHEXANOYL)-, DL- |
| CAS: | 876858-57-0 |
| English Synonyms: | VALINE, N-(2-CHLOROHEXANOYL)-, DL- |
| MDL Number.: | MFCD17018463 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | ClC(C(=O)NC(C(C)C)C(=O)O)CCCC |
| InChi: | InChI=1S/C11H20ClNO3/c1-4-5-6-8(12)10(14)13-9(7(2)3)11(15)16/h7-9H,4-6H2,1-3H3,(H,13,14)(H,15,16) |
| InChiKey: | InChIKey=JQCKOYISDJSUID-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.