* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PERFLUORO-N-1,2,3,4-13C4-OCTANOIC ACID |
English Synonyms: | PERFLUORO-N-1,2,3,4-13C4-OCTANOIC ACID |
MDL Number.: | MFCD17019167 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | O[13C](=O)[13C](F)(F)[13C](F)(F)[13C](F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
InChi: | InChI=1S/C8HF15O2/c9-2(10,1(24)25)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23/h(H,24,25)/i1+1,2+1,3+1,4+1 |
InChiKey: | InChIKey=SNGREZUHAYWORS-JCDJMFQYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.