* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PERFLUORO-N-HEXANOIC ACID-13C2 |
| English Synonyms: | PERFLUORO-N-HEXANOIC ACID-13C2 |
| MDL Number.: | MFCD17019180 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | O[13C](=O)[13C](F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChi: | InChI=1S/C6HF11O2/c7-2(8,1(18)19)3(9,10)4(11,12)5(13,14)6(15,16)17/h(H,18,19)/i1+1,2+1 |
| InChiKey: | InChIKey=PXUULQAPEKKVAH-ZDOIIHCHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.