* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | R1487 |
English Synonyms: | R1487 |
MDL Number.: | MFCD17019339 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | Cn1c2c(cc(c1=O)Oc3cc(ccc3F)F)cnc(n2)NC4CCOCC4.Cl |
InChi: | InChI=1S/C19H18F2N4O3.ClH/c1-25-17-11(10-22-19(24-17)23-13-4-6-27-7-5-13)8-16(18(25)26)28-15-9-12(20)2-3-14(15)21;/h2-3,8-10,13H,4-7H2,1H3,(H,22,23,24);1H |
InChiKey: | InChIKey=LHMBPOCPEWWFGE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.