* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FMOC-HYP-OBZ |
| CAS: | 439290-35-4 |
| English Synonyms: | FMOC-HYP-OBZL ; FMOC-HYP-OBZ |
| MDL Number.: | MFCD17019486 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)COC(=O)[C@@H]2C[C@H](CN2C(=O)OCC3c4ccccc4-c5c3cccc5)O |
| InChi: | InChI=1S/C27H25NO5/c29-19-14-25(26(30)32-16-18-8-2-1-3-9-18)28(15-19)27(31)33-17-24-22-12-6-4-10-20(22)21-11-5-7-13-23(21)24/h1-13,19,24-25,29H,14-17H2/t19-,25+/m1/s1 |
| InChiKey: | InChIKey=CVHUWFLTKKZKSQ-CLOONOSVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.