* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BIO-FARMA BF004343 |
| English Synonyms: | BIO-FARMA BF004343 |
| MDL Number.: | MFCD17019507 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc(c(c1)CN2[C@@H]3CCCCC3NC2=O)Cl |
| InChi: | InChI=1S/C14H17ClN2O/c15-11-6-2-1-5-10(11)9-17-13-8-4-3-7-12(13)16-14(17)18/h1-2,5-6,12-13H,3-4,7-9H2,(H,16,18)/t12?,13-/m1/s1 |
| InChiKey: | InChIKey=LVIZLOZXRWBAEH-ZGTCLIOFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.