* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DECYL[(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]AMINE |
| English Synonyms: | DECYL[(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]AMINE |
| MDL Number.: | MFCD17020039 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCCCCCCCCNCc1nncn1C |
| InChi: | InChI=1S/C14H28N4/c1-3-4-5-6-7-8-9-10-11-15-12-14-17-16-13-18(14)2/h13,15H,3-12H2,1-2H3 |
| InChiKey: | InChIKey=QXKZNKANNQOVRC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.