* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BUTYL(2-(4H,5H,6H,7H-THIENO[3,2-C]PYRIDIN-5-YL)PROPYL)AMINE |
| English Synonyms: | BUTYL(2-(4H,5H,6H,7H-THIENO[3,2-C]PYRIDIN-5-YL)PROPYL)AMINE |
| MDL Number.: | MFCD17020640 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCCNCC(C)N1CCc2c(ccs2)C1 |
| InChi: | InChI=1S/C14H24N2S/c1-3-4-7-15-10-12(2)16-8-5-14-13(11-16)6-9-17-14/h6,9,12,15H,3-5,7-8,10-11H2,1-2H3 |
| InChiKey: | InChIKey=FVLZEGTZSIKMOW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.