* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BUTYL[2-(2,3-DIHYDRO-1H-INDOL-1-YL)PROPYL]AMINE |
| English Synonyms: | BUTYL[2-(2,3-DIHYDRO-1H-INDOL-1-YL)PROPYL]AMINE |
| MDL Number.: | MFCD17020643 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCCNCC(C)N1CCc2c1cccc2 |
| InChi: | InChI=1S/C15H24N2/c1-3-4-10-16-12-13(2)17-11-9-14-7-5-6-8-15(14)17/h5-8,13,16H,3-4,9-12H2,1-2H3 |
| InChiKey: | InChIKey=XECZYUPKNIXRMD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.