* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC744479 |
| English Synonyms: | BCH-RESEARCH BC744479 |
| MDL Number.: | MFCD17020756 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | CNc1ccc(cc1[N+](=O)[O-])C(=O)NCC(=O)N |
| InChi: | InChI=1S/C10H12N4O4/c1-12-7-3-2-6(4-8(7)14(17)18)10(16)13-5-9(11)15/h2-4,12H,5H2,1H3,(H2,11,15)(H,13,16) |
| InChiKey: | InChIKey=JIHSFJVZXBWEQL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.