* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BUTYL[(1-PHENYL-1H-1,2,3,4-TETRAZOL-5-YL)METHYL]AMINE |
| English Synonyms: | BUTYL[(1-PHENYL-1H-1,2,3,4-TETRAZOL-5-YL)METHYL]AMINE |
| MDL Number.: | MFCD17020763 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCCCNCc1nnnn1c2ccccc2 |
| InChi: | InChI=1S/C12H17N5/c1-2-3-9-13-10-12-14-15-16-17(12)11-7-5-4-6-8-11/h4-8,13H,2-3,9-10H2,1H3 |
| InChiKey: | InChIKey=REWNGPPMMCDBAO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.