* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-N-(4H-1,2,4-TRIAZOL-3-YL)-2H-1,3-BENZODIOXOLE-5-CARBOXAMIDE |
| English Synonyms: | 7-CHLORO-N-(4H-1,2,4-TRIAZOL-3-YL)-2H-1,3-BENZODIOXOLE-5-CARBOXAMIDE |
| MDL Number.: | MFCD17021400 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | c1c(cc(c2c1OCO2)Cl)C(=O)Nc3[nH]cnn3 |
| InChi: | InChI=1S/C10H7ClN4O3/c11-6-1-5(2-7-8(6)18-4-17-7)9(16)14-10-12-3-13-15-10/h1-3H,4H2,(H2,12,13,14,15,16) |
| InChiKey: | InChIKey=GBHZHMZBXKESNC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.