* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-1-(OXOLAN-2-YLMETHYL)-2,3-DIHYDRO-1H-INDOLE-2,3-DIONE |
| English Synonyms: | 7-CHLORO-1-(OXOLAN-2-YLMETHYL)-2,3-DIHYDRO-1H-INDOLE-2,3-DIONE |
| MDL Number.: | MFCD17022520 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1cc2c(c(c1)Cl)N(C(=O)C2=O)CC3CCCO3 |
| InChi: | InChI=1S/C13H12ClNO3/c14-10-5-1-4-9-11(10)15(13(17)12(9)16)7-8-3-2-6-18-8/h1,4-5,8H,2-3,6-7H2 |
| InChiKey: | InChIKey=HJWVHQPMHPAMDU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.