Molecular Structure:
CCD No.:CCD03302991
OTAVA-BB 1922687
Formula:C14 H19 N O3
MolWeight:249.308
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1922687 |
| English Synonyms： | OTAVA-BB 1922687 |
| MDL Number.： | MFCD17022607 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | c1cc2c(cc1C(CNC3CC3)O)OCCCO2 |
| InChi： | InChI=1S/C14H19NO3/c16-12(9-15-11-3-4-11)10-2-5-13-14(8-10)18-7-1-6-17-13/h2,5,8,11-12,15-16H,1,3-4,6-7,9H2 |
| InChiKey： | InChIKey=NRWFMPZFCGSGOW-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
