* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 2154821 |
| English Synonyms: | OTAVA-BB 2154821 |
| MDL Number.: | MFCD17023675 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCN(c1ccccc1)C(=O)Cn2cc(nn2)CN |
| InChi: | InChI=1S/C13H17N5O/c1-2-18(12-6-4-3-5-7-12)13(19)10-17-9-11(8-14)15-16-17/h3-7,9H,2,8,10,14H2,1H3 |
| InChiKey: | InChIKey=SMDOMQYLUBJWKT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.