* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-([4-(AMINOMETHYL)-1H-1,2,3-TRIAZOL-1-YL]METHYL)-3-METHYL-5H-[1,3]THIAZOLO[3,2-A]PYRIMIDIN-5-ONE |
| English Synonyms: | 7-([4-(AMINOMETHYL)-1H-1,2,3-TRIAZOL-1-YL]METHYL)-3-METHYL-5H-[1,3]THIAZOLO[3,2-A]PYRIMIDIN-5-ONE |
| MDL Number.: | MFCD17023699 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | Cc1csc2n1c(=O)cc(n2)Cn3cc(nn3)CN |
| InChi: | InChI=1S/C11H12N6OS/c1-7-6-19-11-13-8(2-10(18)17(7)11)4-16-5-9(3-12)14-15-16/h2,5-6H,3-4,12H2,1H3 |
| InChiKey: | InChIKey=MPUIYOBCYDBKBE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.