* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-([4-(AMINOMETHYL)-1H-1,2,3-TRIAZOL-1-YL]METHYL)-5H-[1,3,4]THIADIAZOLO[3,2-A]PYRIMIDIN-5-ONE |
| English Synonyms: | 7-([4-(AMINOMETHYL)-1H-1,2,3-TRIAZOL-1-YL]METHYL)-5H-[1,3,4]THIADIAZOLO[3,2-A]PYRIMIDIN-5-ONE |
| MDL Number.: | MFCD17023725 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | c1c(nc2n(c1=O)ncs2)Cn3cc(nn3)CN |
| InChi: | InChI=1S/C9H9N7OS/c10-2-7-4-15(14-13-7)3-6-1-8(17)16-9(12-6)18-5-11-16/h1,4-5H,2-3,10H2 |
| InChiKey: | InChIKey=AYNAGGBHWJCLEA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.