Molecular Structure:
CCD No.:CCD03304065
OTAVA-BB 2164455
Formula:C13 H18 N4 O
MolWeight:246.312
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 2164455 |
| English Synonyms： | OTAVA-BB 2164455 |
| MDL Number.： | MFCD17023727 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | Cc1cccc(c1)OCCCn2cc(nn2)CN |
| InChi： | InChI=1S/C13H18N4O/c1-11-4-2-5-13(8-11)18-7-3-6-17-10-12(9-14)15-16-17/h2,4-5,8,10H,3,6-7,9,14H2,1H3 |
| InChiKey： | InChIKey=DVOBXCVQRPDJAP-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
