* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-1-[(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]-1H-1,3-BENZODIAZOL-2-AMINE |
| English Synonyms: | 7-CHLORO-1-[(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]-1H-1,3-BENZODIAZOL-2-AMINE |
| MDL Number.: | MFCD17028461 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | Cn1cnnc1Cn2c3c(cccc3Cl)nc2N |
| InChi: | InChI=1S/C11H11ClN6/c1-17-6-14-16-9(17)5-18-10-7(12)3-2-4-8(10)15-11(18)13/h2-4,6H,5H2,1H3,(H2,13,15) |
| InChiKey: | InChIKey=GORNKCVMWABMNY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.