* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC672697 |
| English Synonyms: | BCH-RESEARCH BC672697 |
| MDL Number.: | MFCD17028767 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCCn1cc(nc1C)S(=O)(=O)N(CC)CC(=O)O |
| InChi: | InChI=1S/C11H19N3O4S/c1-4-6-13-7-10(12-9(13)3)19(17,18)14(5-2)8-11(15)16/h7H,4-6,8H2,1-3H3,(H,15,16) |
| InChiKey: | InChIKey=BQXYKSLVXUWWBG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.