* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-[(1-ETHYL-1H-IMIDAZOL-2-YL)OXY]-1,2,3,4-TETRAHYDROQUINOLINE |
| English Synonyms: | 8-[(1-ETHYL-1H-IMIDAZOL-2-YL)OXY]-1,2,3,4-TETRAHYDROQUINOLINE |
| MDL Number.: | MFCD17033849 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCn1ccnc1Oc2cccc3c2NCCC3 |
| InChi: | InChI=1S/C14H17N3O/c1-2-17-10-9-16-14(17)18-12-7-3-5-11-6-4-8-15-13(11)12/h3,5,7,9-10,15H,2,4,6,8H2,1H3 |
| InChiKey: | InChIKey=RHDVEHTYYYNJJR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.