* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | TERT-BUTYL((3-[5-(PENTAN-2-YL)-1,3,4-OXADIAZOL-2-YL]PROPYL))AMINE |
| English Synonyms: | TERT-BUTYL((3-[5-(PENTAN-2-YL)-1,3,4-OXADIAZOL-2-YL]PROPYL))AMINE |
| MDL Number.: | MFCD17034183 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCC(C)c1nnc(o1)CCCNC(C)(C)C |
| InChi: | InChI=1S/C14H27N3O/c1-6-8-11(2)13-17-16-12(18-13)9-7-10-15-14(3,4)5/h11,15H,6-10H2,1-5H3 |
| InChiKey: | InChIKey=HVGOEQVVAZPUIY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.