* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL((2-[5-(PYRIDIN-3-YL)-1,3,4-OXADIAZOL-2-YL]ETHYL))AMINE |
| English Synonyms: | PROPYL((2-[5-(PYRIDIN-3-YL)-1,3,4-OXADIAZOL-2-YL]ETHYL))AMINE |
| MDL Number.: | MFCD17034334 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCCNCCc1nnc(o1)c2cccnc2 |
| InChi: | InChI=1S/C12H16N4O/c1-2-6-13-8-5-11-15-16-12(17-11)10-4-3-7-14-9-10/h3-4,7,9,13H,2,5-6,8H2,1H3 |
| InChiKey: | InChIKey=PSKSNQPYKTVDAV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.