* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC776077 |
| English Synonyms: | BCH-RESEARCH BC776077 |
| MDL Number.: | MFCD17035194 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CC(C)NC(=O)CNS(=O)(=O)c1ccc(nc1)N |
| InChi: | InChI=1S/C10H16N4O3S/c1-7(2)14-10(15)6-13-18(16,17)8-3-4-9(11)12-5-8/h3-5,7,13H,6H2,1-2H3,(H2,11,12)(H,14,15) |
| InChiKey: | InChIKey=SGLDHLVVSFHGLS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.