* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC776082 |
| English Synonyms: | BCH-RESEARCH BC776082 |
| MDL Number.: | MFCD17035237 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | c1cc(ncc1S(=O)(=O)NCCCC(=O)N)N |
| InChi: | InChI=1S/C9H14N4O3S/c10-8-4-3-7(6-12-8)17(15,16)13-5-1-2-9(11)14/h3-4,6,13H,1-2,5H2,(H2,10,12)(H2,11,14) |
| InChiKey: | InChIKey=LCKCAMAHZHRRIG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.