* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC776106 |
| English Synonyms: | BCH-RESEARCH BC776106 |
| MDL Number.: | MFCD17035423 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | c1cc(ncc1S(=O)(=O)N(CCC#N)C2CC2)N |
| InChi: | InChI=1S/C11H14N4O2S/c12-6-1-7-15(9-2-3-9)18(16,17)10-4-5-11(13)14-8-10/h4-5,8-9H,1-3,7H2,(H2,13,14) |
| InChiKey: | InChIKey=GAPRCBVBSQBICH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.