* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC776130 |
| English Synonyms: | BCH-RESEARCH BC776130 |
| MDL Number.: | MFCD17035592 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CC(C)(C(=O)N)NS(=O)(=O)c1ccc(nc1)N |
| InChi: | InChI=1S/C9H14N4O3S/c1-9(2,8(11)14)13-17(15,16)6-3-4-7(10)12-5-6/h3-5,13H,1-2H3,(H2,10,12)(H2,11,14) |
| InChiKey: | InChIKey=XYFCCTKETUHULJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.