* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 3557585 |
| English Synonyms: | OTAVA-BB 3557585 |
| MDL Number.: | MFCD17036173 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CN(C1CCS(=O)(=O)C1)C(=O)c2cc(ccn2)N |
| InChi: | InChI=1S/C11H15N3O3S/c1-14(9-3-5-18(16,17)7-9)11(15)10-6-8(12)2-4-13-10/h2,4,6,9H,3,5,7H2,1H3,(H2,12,13) |
| InChiKey: | InChIKey=RNZGTIDNMLISKO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.