* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC938238 |
| English Synonyms: | BCH-RESEARCH BC938238 |
| MDL Number.: | MFCD17037114 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CCCNc1c(cccn1)C(=O)NCC(=O)N |
| InChi: | InChI=1S/C11H16N4O2/c1-2-5-13-10-8(4-3-6-14-10)11(17)15-7-9(12)16/h3-4,6H,2,5,7H2,1H3,(H2,12,16)(H,13,14)(H,15,17) |
| InChiKey: | InChIKey=ZEIZAMGBNMGCQI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.