* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC1130896 |
| English Synonyms: | BCH-RESEARCH BC1130896 |
| MDL Number.: | MFCD17037748 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CCNc1c(cccn1)C(=O)NCC(=O)NC(C)C |
| InChi: | InChI=1S/C13H20N4O2/c1-4-14-12-10(6-5-7-15-12)13(19)16-8-11(18)17-9(2)3/h5-7,9H,4,8H2,1-3H3,(H,14,15)(H,16,19)(H,17,18) |
| InChiKey: | InChIKey=JHCXDPHSINOLJD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.