* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC673505 |
| English Synonyms: | BCH-RESEARCH BC673505 |
| MDL Number.: | MFCD17037790 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CNc1c(cccn1)C(=O)N(C)C2CCS(=O)(=O)C2 |
| InChi: | InChI=1S/C12H17N3O3S/c1-13-11-10(4-3-6-14-11)12(16)15(2)9-5-7-19(17,18)8-9/h3-4,6,9H,5,7-8H2,1-2H3,(H,13,14) |
| InChiKey: | InChIKey=XZAJJVWZSQVLOJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.