* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC1130913 |
| English Synonyms: | BCH-RESEARCH BC1130913 |
| MDL Number.: | MFCD17038253 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CCNc1c(cccn1)C(=O)NC(C)C(=O)NC |
| InChi: | InChI=1S/C12H18N4O2/c1-4-14-10-9(6-5-7-15-10)12(18)16-8(2)11(17)13-3/h5-8H,4H2,1-3H3,(H,13,17)(H,14,15)(H,16,18) |
| InChiKey: | InChIKey=MUFWZGOHSDWUJZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.