* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(TRIFLUOROMETHYL)-2H,3H-[1,4]DIOXINO[2,3-G]QUINOLIN-9-AMINE |
| English Synonyms: | 7-(TRIFLUOROMETHYL)-2H,3H-[1,4]DIOXINO[2,3-G]QUINOLIN-9-AMINE |
| MDL Number.: | MFCD17040415 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1c2c(cc(nc2cc3c1OCCO3)C(F)(F)F)N |
| InChi: | InChI=1S/C12H9F3N2O2/c13-12(14,15)11-4-7(16)6-3-9-10(5-8(6)17-11)19-2-1-18-9/h3-5H,1-2H2,(H2,16,17) |
| InChiKey: | InChIKey=RGPNGNPATHSECS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.