* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-ETHYL-2H,3H-[1,4]DIOXINO[2,3-G]QUINOLIN-9-AMINE |
| English Synonyms: | 7-ETHYL-2H,3H-[1,4]DIOXINO[2,3-G]QUINOLIN-9-AMINE |
| MDL Number.: | MFCD17040416 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCc1cc(c2cc3c(cc2n1)OCCO3)N |
| InChi: | InChI=1S/C13H14N2O2/c1-2-8-5-10(14)9-6-12-13(7-11(9)15-8)17-4-3-16-12/h5-7H,2-4H2,1H3,(H2,14,15) |
| InChiKey: | InChIKey=XMOIDINXAIPELF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.