* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(HEXAN-2-YL)-5,6-DIMETHYL-7H-PYRROLO[2,3-D]PYRIMIDIN-4-AMINE |
| English Synonyms: | 7-(HEXAN-2-YL)-5,6-DIMETHYL-7H-PYRROLO[2,3-D]PYRIMIDIN-4-AMINE |
| MDL Number.: | MFCD17041007 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCCC(C)n1c(c(c2c1ncnc2N)C)C |
| InChi: | InChI=1S/C14H22N4/c1-5-6-7-9(2)18-11(4)10(3)12-13(15)16-8-17-14(12)18/h8-9H,5-7H2,1-4H3,(H2,15,16,17) |
| InChiKey: | InChIKey=PNTIZDAYGTVIAL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.