* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-2-[2-(PIPERIDIN-4-YL)ETHYL]-1H-1,3-BENZODIAZOLE |
| English Synonyms: | 7-CHLORO-2-[2-(PIPERIDIN-4-YL)ETHYL]-1H-1,3-BENZODIAZOLE |
| MDL Number.: | MFCD17042131 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1cc2c(c(c1)Cl)[nH]c(n2)CCC3CCNCC3 |
| InChi: | InChI=1S/C14H18ClN3/c15-11-2-1-3-12-14(11)18-13(17-12)5-4-10-6-8-16-9-7-10/h1-3,10,16H,4-9H2,(H,17,18) |
| InChiKey: | InChIKey=QFQATDOKKAZVJQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.