* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OXAN-4-YL 3-(PIPERIDIN-4-YL)PROPANOATE |
| English Synonyms: | OXAN-4-YL 3-(PIPERIDIN-4-YL)PROPANOATE |
| MDL Number.: | MFCD17042195 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | C1CNCCC1CCC(=O)OC2CCOCC2 |
| InChi: | InChI=1S/C13H23NO3/c15-13(17-12-5-9-16-10-6-12)2-1-11-3-7-14-8-4-11/h11-12,14H,1-10H2 |
| InChiKey: | InChIKey=AXWKSWOBUJXQCJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.