* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(OXANE-2-CARBONYL)-3,4-DIHYDRO-2H-1,5-BENZODIOXEPINE |
| English Synonyms: | 7-(OXANE-2-CARBONYL)-3,4-DIHYDRO-2H-1,5-BENZODIOXEPINE |
| MDL Number.: | MFCD17042702 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1cc2c(cc1C(=O)C3CCCCO3)OCCCO2 |
| InChi: | InChI=1S/C15H18O4/c16-15(13-4-1-2-7-18-13)11-5-6-12-14(10-11)19-9-3-8-17-12/h5-6,10,13H,1-4,7-9H2 |
| InChiKey: | InChIKey=WNUGHPZDJSECKE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.